Difference between revisions of "CPD-8843"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8843 CPD-8843] == * smiles: ** C=CC(CCC=C(CCC=C(C)C)C)(O)C * common name: ** (3R,6E)-neroli...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C=CC(CCC=C(CCC=C(C)C)C)(O)C | ** C=CC(CCC=C(CCC=C(C)C)C)(O)C | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 222.37 | ** 222.37 | ||
| + | * inchi key: | ||
| + | ** InChIKey=FQTLCLSUCSAZDY-GOFCXVBSSA-N | ||
| + | * common name: | ||
| + | ** (3R,6E)-nerolidol | ||
* Synonym(s): | * Synonym(s): | ||
** (E)-nerolidol | ** (E)-nerolidol | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59959 59959] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59959 59959] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11241545 11241545] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11241545 11241545] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C19746 C19746] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.9416582.html 9416582] | ||
{{#set: smiles=C=CC(CCC=C(CCC=C(C)C)C)(O)C}} | {{#set: smiles=C=CC(CCC=C(CCC=C(C)C)C)(O)C}} | ||
| − | |||
| − | |||
{{#set: molecular weight=222.37 }} | {{#set: molecular weight=222.37 }} | ||
| + | {{#set: inchi key=InChIKey=FQTLCLSUCSAZDY-GOFCXVBSSA-N}} | ||
| + | {{#set: common name=(3R,6E)-nerolidol}} | ||
{{#set: common name=(E)-nerolidol|(3R)-(E)-nerolidol}} | {{#set: common name=(E)-nerolidol|(3R)-(E)-nerolidol}} | ||
{{#set: consumed by=RXN-8619}} | {{#set: consumed by=RXN-8619}} | ||
{{#set: produced by=RXN-11575}} | {{#set: produced by=RXN-11575}} | ||
Latest revision as of 18:04, 9 January 2019
Contents
Metabolite CPD-8843
- smiles:
- C=CC(CCC=C(CCC=C(C)C)C)(O)C
- molecular weight:
- 222.37
- inchi key:
- InChIKey=FQTLCLSUCSAZDY-GOFCXVBSSA-N
- common name:
- (3R,6E)-nerolidol
- Synonym(s):
- (E)-nerolidol
- (3R)-(E)-nerolidol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
