Difference between revisions of "RXN-7813"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009277001 == * left end position: ** 443037 * transcription direction: ** NEGATIVE * right end position: ** 447555 * centisome position: ** 97...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N |
− | * | + | * common name: |
− | ** | + | ** 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol |
− | * | + | * molecular weight: |
− | ** | + | ** 821.32 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-9235]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-9234]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986248 50986248] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64180 64180] |
− | {{#set: | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N}} |
+ | {{#set: common name=2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol}} | ||
+ | {{#set: molecular weight=821.32 }} | ||
+ | {{#set: common name=2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol}} | ||
+ | {{#set: consumed by=RXN-9235}} | ||
+ | {{#set: produced by=RXN-9234}} |
Revision as of 11:47, 18 January 2018
Contents
Metabolite CPD-9869
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N
- common name:
- 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol
- molecular weight:
- 821.32
- Synonym(s):
- 2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links