Difference between revisions of "PWY-4621"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6886 PWY-6886] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-186801 TAX-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6886 PWY-6886] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-186801 TAX-186801] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
* common name: | * common name: | ||
− | ** | + | ** 1-butanol autotrophic biosynthesis (engineered) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | * '''8''' reaction(s) found | |
− | * [[RXN- | + | ** [[3PGAREARR-RXN]] |
− | * [[ | + | ** [[PWY-101]] |
− | == Reaction(s) | + | ** [[PEPDEPHOS-RXN]] |
+ | ** [[PYRUVDEH-RXN]] | ||
+ | ** [[CALVIN-PWY]] | ||
+ | ** [[PWY-6883]] | ||
+ | ** [[2PGADEHYDRAT-RXN]] | ||
+ | ** [[PHOSGLYPHOS-RXN]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''0''' reaction(s) not found | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-186801}} | |
− | + | {{#set: taxonomic range=TAX-33682}} | |
− | + | {{#set: taxonomic range=TAX-1117}} | |
− | + | {{#set: common name=1-butanol autotrophic biosynthesis (engineered)}} | |
− | + | {{#set: reaction found=8}} | |
− | + | {{#set: reaction not found=0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:05, 18 January 2018
Pathway PWY-6886
- taxonomic range:
- common name:
- 1-butanol autotrophic biosynthesis (engineered)
- Synonym(s):
Reaction(s) found
- 8 reaction(s) found
Reaction(s) not found
- 0 reaction(s) not found