Difference between revisions of "S-LACTOYL-GLUTATHIONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == * smiles: ** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O | ** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O | ||
+ | * molecular weight: | ||
+ | ** 378.376 | ||
* inchi key: | * inchi key: | ||
** InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M | ** InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M | ||
* common name: | * common name: | ||
** (R)-S-lactoylglutathione | ** (R)-S-lactoylglutathione | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** S-D-lactoylglutathione | ** S-D-lactoylglutathione | ||
Line 19: | Line 19: | ||
* [[GLYOXI-RXN]] | * [[GLYOXI-RXN]] | ||
== External links == | == External links == | ||
+ | * BIGG : lgt__S | ||
* CAS : 25138-66-3 | * CAS : 25138-66-3 | ||
− | |||
− | |||
* HMDB : HMDB01066 | * HMDB : HMDB01066 | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57474 57474] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57474 57474] | ||
− | * | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03451 C03451] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878377 46878377] | ||
{{#set: smiles=CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} | {{#set: smiles=CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} | ||
+ | {{#set: molecular weight=378.376 }} | ||
{{#set: inchi key=InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M}} | {{#set: inchi key=InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M}} | ||
{{#set: common name=(R)-S-lactoylglutathione}} | {{#set: common name=(R)-S-lactoylglutathione}} | ||
− | |||
{{#set: common name=S-D-lactoylglutathione|D-lactoylglutathione}} | {{#set: common name=S-D-lactoylglutathione|D-lactoylglutathione}} | ||
{{#set: consumed by=GLYOXII-RXN}} | {{#set: consumed by=GLYOXII-RXN}} | ||
{{#set: reversible reaction associated=GLYOXI-RXN}} | {{#set: reversible reaction associated=GLYOXI-RXN}} |
Latest revision as of 19:16, 9 January 2019
Contents
Metabolite S-LACTOYL-GLUTATHIONE
- smiles:
- CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
- molecular weight:
- 378.376
- inchi key:
- InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M
- common name:
- (R)-S-lactoylglutathione
- Synonym(s):
- S-D-lactoylglutathione
- D-lactoylglutathione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.