Difference between revisions of "HIS"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * smiles: ** C1(NC=NC=1CC(C(=O)[O-])[N+]) * inchi key: ** InChIKey=HNDVDQJCIGZPNO-Y...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(NC=NC=1CC(C(=O)[O-])[N+]) | ** C1(NC=NC=1CC(C(=O)[O-])[N+]) | ||
+ | * molecular weight: | ||
+ | ** 155.156 | ||
* inchi key: | * inchi key: | ||
** InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N | ** InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N | ||
* common name: | * common name: | ||
** L-histidine | ** L-histidine | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** glyoxaline-5-alanine | ** glyoxaline-5-alanine | ||
Line 19: | Line 19: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[HISTIDINE--TRNA-LIGASE-RXN]] | ||
* [[HISTIDINE-AMMONIA-LYASE-RXN]] | * [[HISTIDINE-AMMONIA-LYASE-RXN]] | ||
* [[biomass_rxn]] | * [[biomass_rxn]] | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[HISTALDEHYD-RXN]] | * [[HISTALDEHYD-RXN]] | ||
+ | * [[RXN-8001]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * METABOLIGHTS : MTBLC57595 | ||
+ | * BIGG : his__L | ||
* CAS : 71-00-1 | * CAS : 71-00-1 | ||
− | |||
− | |||
− | |||
* HMDB : HMDB00177 | * HMDB : HMDB00177 | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57595 57595] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57595 57595] | ||
− | * | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00135 C00135] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971009 6971009] | ||
{{#set: smiles=C1(NC=NC=1CC(C(=O)[O-])[N+])}} | {{#set: smiles=C1(NC=NC=1CC(C(=O)[O-])[N+])}} | ||
+ | {{#set: molecular weight=155.156 }} | ||
{{#set: inchi key=InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N}} | {{#set: inchi key=InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N}} | ||
{{#set: common name=L-histidine}} | {{#set: common name=L-histidine}} | ||
− | |||
{{#set: common name=glyoxaline-5-alanine|α-amino-4-imidazoleproprionic acid|(S)-α-amino-1H-imidazole-4-propanoic acid|H|histidine|his|L-his}} | {{#set: common name=glyoxaline-5-alanine|α-amino-4-imidazoleproprionic acid|(S)-α-amino-1H-imidazole-4-propanoic acid|H|histidine|his|L-his}} | ||
− | {{#set: consumed by=HISTIDINE- | + | {{#set: consumed by=HISTIDINE--TRNA-LIGASE-RXN|HISTIDINE-AMMONIA-LYASE-RXN|biomass_rxn}} |
− | {{#set: produced by= | + | {{#set: produced by=HISTALDEHYD-RXN|RXN-8001}} |
Latest revision as of 19:17, 9 January 2019
Contents
Metabolite HIS
- smiles:
- C1(NC=NC=1CC(C(=O)[O-])[N+])
- molecular weight:
- 155.156
- inchi key:
- InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N
- common name:
- L-histidine
- Synonym(s):
- glyoxaline-5-alanine
- α-amino-4-imidazoleproprionic acid
- (S)-α-amino-1H-imidazole-4-propanoic acid
- H
- histidine
- his
- L-his
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC57595
- BIGG : his__L
- CAS : 71-00-1
- HMDB : HMDB00177
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C1(NC=NC=1CC(C(=O)[O-])[N+])" cannot be used as a page name in this wiki.