Difference between revisions of "CHC T00010260001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == * smiles: ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10841 RXN-10841] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10841 RXN-10841] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M
+
** [http://enzyme.expasy.org/EC/1.1.1.300 EC-1.1.1.300]
−
* common name:
+
−
** leukotriene-D4
+
−
* molecular weight:
+
−
** 495.653   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN66-336]]
+
** 1 [[NADP]][c] '''+''' 1 [[CPD-13524]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[RETINAL]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADP+[c] '''+''' 1 all-trans-retinol[c] '''<=>''' 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 all-trans-retinal[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00009571001_1]]
 +
** [[pantograph]]-[[a.taliana]]
 +
== Pathways  ==
 +
* [[PWY-6861]], the visual cycle I (vertebrates): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6861 PWY-6861]
 +
** '''1''' reactions found over '''12''' reactions in the full pathway
 +
* [[PWY-6857]], retinol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6857 PWY-6857]
 +
** '''3''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[a.taliana]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940265 52940265]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25033 25033]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63166 63166]
+
** [http://www.genome.jp/dbget-bin/www_bget?R08379 R08379]
−
{{#set: smiles=CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O}}
+
{{#set: direction=REVERSIBLE}}
−
{{#set: inchi key=InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M}}
+
{{#set: ec number=EC-1.1.1.300}}
−
{{#set: common name=leukotriene-D4}}
+
{{#set: gene associated=CHC_T00009571001_1}}
−
{{#set: molecular weight=495.653    }}
+
{{#set: in pathway=PWY-6861|PWY-6857}}
−
{{#set: produced by=RXN66-336}}
+
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction tool=pantograph}}
 +
{{#set: reconstruction source=a.taliana}}

Revision as of 11:05, 18 January 2018

Reaction RXN-10841

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NADP+[c] + 1 all-trans-retinol[c] <=> 1 H+[c] + 1 NADPH[c] + 1 all-trans-retinal[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6861, the visual cycle I (vertebrates): PWY-6861
    • 1 reactions found over 12 reactions in the full pathway
  • PWY-6857, retinol biosynthesis: PWY-6857
    • 3 reactions found over 7 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00010260001_1&oldid=6362"