Difference between revisions of "Scaffold20 461442 460650"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL LANOSTEROL] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Ac-N-terminal-L-valine N-Ac-N-terminal-L-valine] == * common name: ** an N-terminal Nα-...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL LANOSTEROL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Ac-N-terminal-L-valine N-Ac-N-terminal-L-valine] ==
* smiles:
+
** CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
* inchi key:
+
** InChIKey=CAHGCLMLTWQZNJ-BQNIITSRSA-N
+
 
* common name:
 
* common name:
** lanosterol
+
** an N-terminal Nα-acetyl-L-valyl-[protein]
* molecular weight:
+
** 426.724   
+
 
* Synonym(s):
 
* Synonym(s):
** 4,4,14α-trimethyl-5α-cholesta-8,24-dien-3β-ol
+
** a [protein] N-terminal Nα-acetyl-L-valine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN3O-130]]
 
* [[RXN66-303]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17859]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 79-63-0
+
{{#set: common name=an N-terminal Nα-acetyl-L-valyl-[protein]}}
* DRUGBANK : DB03696
+
{{#set: common name=a [protein] N-terminal Nα-acetyl-L-valine}}
* PUBCHEM:
+
{{#set: produced by=RXN-17859}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=246983 246983]
+
* HMDB : HMDB01251
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01724 C01724]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16521 16521]
+
* METABOLIGHTS : MTBLC16521
+
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: inchi key=InChIKey=CAHGCLMLTWQZNJ-BQNIITSRSA-N}}
+
{{#set: common name=lanosterol}}
+
{{#set: molecular weight=426.724    }}
+
{{#set: common name=4,4,14α-trimethyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: consumed by=RXN3O-130|RXN66-303}}
+

Revision as of 11:06, 18 January 2018

Metabolite N-Ac-N-terminal-L-valine

  • common name:
    • an N-terminal Nα-acetyl-L-valyl-[protein]
  • Synonym(s):
    • a [protein] N-terminal Nα-acetyl-L-valine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal Nα-acetyl-L-valyl-[protein" cannot be used as a page name in this wiki.
"a [protein] N-terminal Nα-acetyl-L-valine" cannot be used as a page name in this wiki.