Difference between revisions of "RXN-9230"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-CD-S-SP-Complex S-CD-S-SP-Complex] == * common name: ** an S-sulfanyl-[cysteine desulfurase]-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12125 CPD-12125] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12125 CPD-12125] == |
| + | * smiles: | ||
| + | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C | ||
| + | * inchi key: | ||
| + | ** InChIKey=VFGNPJRRTKMYKN-LJWNYQGCSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** menaquinol-7 |
| + | * molecular weight: | ||
| + | ** 651.026 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** menaquinol(7) | ||
| + | ** MKH2-7 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9191]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=447918 447918] |
| − | {{#set: produced by=RXN- | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.394875.html 394875] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64834 64834] | ||
| + | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C}} | ||
| + | {{#set: inchi key=InChIKey=VFGNPJRRTKMYKN-LJWNYQGCSA-N}} | ||
| + | {{#set: common name=menaquinol-7}} | ||
| + | {{#set: molecular weight=651.026 }} | ||
| + | {{#set: common name=menaquinol(7)|MKH2-7}} | ||
| + | {{#set: produced by=RXN-9191}} | ||
Revision as of 11:07, 18 January 2018
Contents
Metabolite CPD-12125
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C
- inchi key:
- InChIKey=VFGNPJRRTKMYKN-LJWNYQGCSA-N
- common name:
- menaquinol-7
- molecular weight:
- 651.026
- Synonym(s):
- menaquinol(7)
- MKH2-7
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
