Difference between revisions of "PWY-46"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00010036001_1 == * Synonym(s): == Reactions associated == * POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN ** pantograph-galdieria.sulphurari...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9000 CPD-9000] == * smiles: ** C(CCC(C([O-])=O)[N+])(NCCCC(=O)[O-])=O * inchi key: ** InChI...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9000 CPD-9000] == |
| + | * smiles: | ||
| + | ** C(CCC(C([O-])=O)[N+])(NCCCC(=O)[O-])=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=MKYPKZSGLSOGLL-LURJTMIESA-M | ||
| + | * common name: | ||
| + | ** 4-(γ-L-glutamylamino)butanoate | ||
| + | * molecular weight: | ||
| + | ** 231.228 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** γ-glu-GABA | ||
| + | ** γ-glutamyl-γ-aminobutyric acid | ||
| + | ** γ-glutamyl-γ-aminobutyrate | ||
| + | ** γ-glutamyl-γ-aminobutanoate | ||
| + | ** 4-(glutamylamino)butanoate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN0-3942]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15767 C15767] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58800 58800] | ||
| + | * BIGG : gg4abut | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245457 25245457] | ||
| + | * HMDB : HMDB12161 | ||
| + | {{#set: smiles=C(CCC(C([O-])=O)[N+])(NCCCC(=O)[O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=MKYPKZSGLSOGLL-LURJTMIESA-M}} | ||
| + | {{#set: common name=4-(γ-L-glutamylamino)butanoate}} | ||
| + | {{#set: molecular weight=231.228 }} | ||
| + | {{#set: common name=γ-glu-GABA|γ-glutamyl-γ-aminobutyric acid|γ-glutamyl-γ-aminobutyrate|γ-glutamyl-γ-aminobutanoate|4-(glutamylamino)butanoate}} | ||
| + | {{#set: consumed by=RXN0-3942}} | ||
Revision as of 11:08, 18 January 2018
Contents
Metabolite CPD-9000
- smiles:
- C(CCC(C([O-])=O)[N+])(NCCCC(=O)[O-])=O
- inchi key:
- InChIKey=MKYPKZSGLSOGLL-LURJTMIESA-M
- common name:
- 4-(γ-L-glutamylamino)butanoate
- molecular weight:
- 231.228
- Synonym(s):
- γ-glu-GABA
- γ-glutamyl-γ-aminobutyric acid
- γ-glutamyl-γ-aminobutyrate
- γ-glutamyl-γ-aminobutanoate
- 4-(glutamylamino)butanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CCC(C([O-])=O)[N+])(NCCCC(=O)[O-])=O" cannot be used as a page name in this wiki.
