Difference between revisions of "CPD-18776"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Plastoquinols Plastoquinols] == * common name: ** a plastoquinol * Synonym(s): ** PQ == Reacti...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18776 CPD-18776] == * smiles: ** COC1(C(=O)CC(CO)(O)CC(O)=1) * common name: ** (R)-4-deoxyg...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18776 CPD-18776] == |
+ | * smiles: | ||
+ | ** COC1(C(=O)CC(CO)(O)CC(O)=1) | ||
* common name: | * common name: | ||
− | ** | + | ** (R)-4-deoxygadusol |
+ | * inchi key: | ||
+ | ** InChIKey=ZONRIYAALKITGT-MRVPVSSYSA-N | ||
+ | * molecular weight: | ||
+ | ** 188.18 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-17366]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-17370]] | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=COC1(C(=O)CC(CO)(O)CC(O)=1)}} |
− | {{#set: common name= | + | {{#set: common name=(R)-4-deoxygadusol}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=ZONRIYAALKITGT-MRVPVSSYSA-N}} |
− | {{#set: produced by=RXN- | + | {{#set: molecular weight=188.18 }} |
+ | {{#set: produced by=RXN-17366}} | ||
+ | {{#set: consumed or produced by=RXN-17370}} |
Revision as of 11:47, 18 January 2018
Contents
Metabolite CPD-18776
- smiles:
- COC1(C(=O)CC(CO)(O)CC(O)=1)
- common name:
- (R)-4-deoxygadusol
- inchi key:
- InChIKey=ZONRIYAALKITGT-MRVPVSSYSA-N
- molecular weight:
- 188.18
- Synonym(s):