Difference between revisions of "CHC T00008261001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_CU+2 ExchangeSeed_CU+2] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formu...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_CU+2 ExchangeSeed_CU+2] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[CU+2]][C-BOUNDARY] '''<=>''' 1.0 [[CU+2]][e] |
− | + | * With common name(s): | |
− | + | ** 1.0 Cu2+[C-BOUNDARY] '''<=>''' 1.0 Cu2+[e] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | * | + | == Pathways == |
− | * | + | == Reconstruction information == |
− | * [ | + | * [[manual]]: |
− | + | ** [[added to manage seeds from boundary to extracellular compartment]] | |
− | == | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=manual}} | |
− | + | {{#set: reconstruction source=added to manage seeds from boundary to extracellular compartment}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:09, 18 January 2018
Contents
Reaction ExchangeSeed_CU+2
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 Cu2+[C-BOUNDARY] <=> 1.0 Cu2+[e]