Difference between revisions of "PWY-5499"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] == * smiles: ** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-] * inchi key: ** InChIKe...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5710 PWY-5710] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4070 TAX-40...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5710 PWY-5710] ==
* smiles:
+
* taxonomic range:
** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4070 TAX-4070]
* inchi key:
+
** InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 4-hydroxy-2-nonenal-[L-Cys] conjugate
+
** capsaicin biosynthesis
* molecular weight:
+
** 277.378   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** capsaicinoids biosynthesis
 +
** hot pepper biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
* '''1''' reaction(s) found
* [[RXN-13677]]
+
** [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''5''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8926 RXN-8926]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8927 RXN-8927]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.101-RXN 4.2.1.101-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8925 RXN-8925]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=4.1.2.41-RXN 4.1.2.41-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4070}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657989 90657989]
+
{{#set: common name=capsaicin biosynthesis}}
{{#set: smiles=CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]}}
+
{{#set: common name=capsaicinoids biosynthesis|hot pepper biosynthesis}}
{{#set: inchi key=InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N}}
+
{{#set: reaction found=1}}
{{#set: common name=4-hydroxy-2-nonenal-[L-Cys] conjugate}}
+
{{#set: reaction not found=5}}
{{#set: molecular weight=277.378    }}
+
{{#set: produced by=RXN-13677}}
+

Revision as of 11:10, 18 January 2018

Pathway PWY-5710

  • taxonomic range:
  • common name:
    • capsaicin biosynthesis
  • Synonym(s):
    • capsaicinoids biosynthesis
    • hot pepper biosynthesis

Reaction(s) found

Reaction(s) not found

External links