Difference between revisions of "GLC"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYINOSINE DEOXYINOSINE] == * smiles: ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(O)N=CN=C23))) * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17788 RXN-17788] == * direction: ** LEFT-TO-RIGHT * common name: ** Putative Acyl-COA dehydroge...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17788 RXN-17788] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Putative Acyl-COA dehydrogenase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.3.8 EC-1.3.8] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[PROTON]][c] '''+''' 1 [[CPD-10269]][c] '''+''' 1 [[ETF-Oxidized]][c] '''=>''' 1 [[CPD-19162]][c] '''+''' 1 [[ETF-Reduced]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 H+[c] '''+''' 1 palmitoleoyl-CoA[c] '''+''' 1 an oxidized electron-transfer flavoprotein[c] '''=>''' 1 (2E,9Z)-hexadecenoyl-CoA[c] '''+''' 1 a reduced electron-transfer flavoprotein[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[CHC_T00009166001]] | ||
| + | ** ORIGINAL_GENOME | ||
| + | ***AUTOMATED-NAME-MATCH | ||
| + | * [[CHC_T00009166001_1]] | ||
| + | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[galdieria.sulphuraria]] | ||
| + | * [[annotation]]: | ||
| + | ** [[pathwaytools]]: | ||
| + | *** [[original_genome]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=Putative Acyl-COA dehydrogenase}} | |
| − | + | {{#set: ec number=EC-1.3.8}} | |
| − | + | {{#set: gene associated=CHC_T00009166001|CHC_T00009166001_1}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=galdieria.sulphuraria}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | {{#set: reconstruction source=original_genome}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 11:10, 18 January 2018
Contents
Reaction RXN-17788
- direction:
- LEFT-TO-RIGHT
- common name:
- Putative Acyl-COA dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 CPD-10269[c] + 1 ETF-Oxidized[c] => 1 CPD-19162[c] + 1 ETF-Reduced[c]
- With common name(s):
- 1 H+[c] + 1 palmitoleoyl-CoA[c] + 1 an oxidized electron-transfer flavoprotein[c] => 1 (2E,9Z)-hexadecenoyl-CoA[c] + 1 a reduced electron-transfer flavoprotein[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- CHC_T00009166001
- ORIGINAL_GENOME
- AUTOMATED-NAME-MATCH
- ORIGINAL_GENOME
- CHC_T00009166001_1
