Difference between revisions of "GAPDHSYNEC-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1414 CPD0-1414] == * smiles: ** CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-161 PWY66-161] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1414 CPD0-1414] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-161 PWY66-161] ==
* smiles:
+
* taxonomic range:
** CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** InChIKey=OFVLGDICTFRJMM-WESIUVDSSA-N
+
 
* common name:
 
* common name:
** tetracycline
+
** ethanol degradation III
* molecular weight:
+
** 444.44   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[TRANS-RXN1HP7-17]]
+
* '''2''' reaction(s) found
== Reaction(s) known to produce the compound ==
+
** [[ACETATE--COA-LIGASE-RXN]]
* [[TRANS-RXN1HP7-17]]
+
** [[RXN66-3]]
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''1''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN66-2 RXN66-2]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33208}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=27885548 27885548]
+
{{#set: common name=ethanol degradation III}}
* CHEBI:
+
{{#set: reaction found=2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71392 71392]
+
{{#set: reaction not found=1}}
{{#set: smiles=CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4))}}
+
{{#set: inchi key=InChIKey=OFVLGDICTFRJMM-WESIUVDSSA-N}}
+
{{#set: common name=tetracycline}}
+
{{#set: molecular weight=444.44    }}
+
{{#set: consumed by=TRANS-RXN1HP7-17}}
+
{{#set: produced by=TRANS-RXN1HP7-17}}
+

Revision as of 11:10, 18 January 2018

Pathway PWY66-161

  • taxonomic range:
  • common name:
    • ethanol degradation III
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links