Difference between revisions of "PWY-6328"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=14-alpha-methylsteroids 14-alpha-methylsteroids] == * common name: ** a 14α-methylsteroid...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-ETCETERA-L-ASPARAGINE ACETYL-ETCETERA-L-ASPARAGINE] == * smiles: ** CC(=O)NC1(C(O)C(O)C(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-ETCETERA-L-ASPARAGINE ACETYL-ETCETERA-L-ASPARAGINE] == |
| + | * smiles: | ||
| + | ** CC(=O)NC1(C(O)C(O)C(CO)OC(NC(=O)CC([N+])C(=O)[O-])1) | ||
| + | * inchi key: | ||
| + | ** InChIKey=YTTRPBWEMMPYSW-HRRFRDKFSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine |
| + | * molecular weight: | ||
| + | ** 335.313 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 1-β-aspartyl-N-acetyl-D-glucosaminylamine | ||
| + | ** N4-(acetyl-β-D-glucosaminyl)asparagine | ||
| + | ** N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.5.1.26-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201322 25201322] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58080 58080] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04540 C04540] | ||
| + | * HMDB : HMDB00489 | ||
| + | {{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(NC(=O)CC([N+])C(=O)[O-])1)}} | ||
| + | {{#set: inchi key=InChIKey=YTTRPBWEMMPYSW-HRRFRDKFSA-N}} | ||
| + | {{#set: common name=N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine}} | ||
| + | {{#set: molecular weight=335.313 }} | ||
| + | {{#set: common name=1-β-aspartyl-N-acetyl-D-glucosaminylamine|N4-(acetyl-β-D-glucosaminyl)asparagine|N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine}} | ||
| + | {{#set: consumed by=3.5.1.26-RXN}} | ||
Revision as of 11:10, 18 January 2018
Contents
Metabolite ACETYL-ETCETERA-L-ASPARAGINE
- smiles:
- CC(=O)NC1(C(O)C(O)C(CO)OC(NC(=O)CC([N+])C(=O)[O-])1)
- inchi key:
- InChIKey=YTTRPBWEMMPYSW-HRRFRDKFSA-N
- common name:
- N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine
- molecular weight:
- 335.313
- Synonym(s):
- 1-β-aspartyl-N-acetyl-D-glucosaminylamine
- N4-(acetyl-β-D-glucosaminyl)asparagine
- N4-(β-N-acetyl-D-glucosaminyl)-L-asparagine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC1(C(O)C(O)C(CO)OC(NC(=O)CC([N+])C(=O)[O-])1)" cannot be used as a page name in this wiki.
