Difference between revisions of "ADENOSYLCOBALAMIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] == * smiles: ** C(C1(=CC=CC=C1O))([O-])=O * inchi key: ** InChIKey=YGSDEFSMJLZ...") |
(Created page with "Category:Gene == Gene CHC_T00009307001_1 == * Synonym(s): == Reactions associated == * RXN-14381 ** pantograph-galdieria.sulphuraria == Pathways associated ==...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009307001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN-14381]] | |
− | * [[ | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
− | == | + | == Pathways associated == |
+ | * [[PWY-7250]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-14381}} | |
− | + | {{#set: pathway associated=PWY-7250}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 12:11, 18 January 2018
Gene CHC_T00009307001_1
- Synonym(s):