Difference between revisions of "CHC T00004094001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLEYL-CPD INDOLEYL-CPD] == * smiles: ** C2(NC1(C=CC=CC=1C(CC#N)=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** stearate biosynthesis II (bacteria and plants) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** stearic acid biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''6''' reaction(s) found |
− | == Reaction(s) | + | ** [[RXN-9633]] |
− | + | ** [[RXN-9632]] | |
+ | ** [[RXN-9635]] | ||
+ | ** [[RXN-9634]] | ||
+ | ** [[RXN-16380]] | ||
+ | ** [[RXN-9548]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''0''' reaction(s) not found | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=stearate biosynthesis II (bacteria and plants)}} | |
− | + | {{#set: common name=stearic acid biosynthesis}} | |
− | + | {{#set: reaction found=6}} | |
− | + | {{#set: reaction not found=0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:12, 18 January 2018
Pathway PWY-5989
- taxonomic range:
- common name:
- stearate biosynthesis II (bacteria and plants)
- Synonym(s):
- stearic acid biosynthesis
Reaction(s) found
Reaction(s) not found
- 0 reaction(s) not found