Difference between revisions of "CHC T00008456001 1"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7168 PWY-7168] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(=O)([O-])C(OP(=O)([O-])[O-])CO |
+ | * inchi key: | ||
+ | ** InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K | ||
+ | * common name: | ||
+ | ** 2-phospho-D-glycerate | ||
+ | * molecular weight: | ||
+ | ** 183.034 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-phospho-(D)-glycerate | ||
+ | ** 2-phospho-(R)-glycerate | ||
+ | ** 2-phospho-D-glyceric acid | ||
+ | ** 2-P-D-glycerate | ||
+ | ** D-Glycerate 2-phosphate | ||
+ | ** D-2-phosphoglycerate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | * [[3PGAREARR-RXN]] |
− | + | * [[2PGADEHYDRAT-RXN]] | |
− | + | * [[RXN-15513]] | |
− | + | * [[RXN-15510]] | |
− | + | ||
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 2553-59-5 |
− | {{#set: | + | * METABOLIGHTS : MTBLC58289 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40467846 40467846] | ||
+ | * HMDB : HMDB03391 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00631 C00631] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58289 58289] | ||
+ | * BIGG : 2pg | ||
+ | {{#set: smiles=C(=O)([O-])C(OP(=O)([O-])[O-])CO}} | ||
+ | {{#set: inchi key=InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K}} | ||
+ | {{#set: common name=2-phospho-D-glycerate}} | ||
+ | {{#set: molecular weight=183.034 }} | ||
+ | {{#set: common name=2-phospho-(D)-glycerate|2-phospho-(R)-glycerate|2-phospho-D-glyceric acid|2-P-D-glycerate|D-Glycerate 2-phosphate|D-2-phosphoglycerate}} | ||
+ | {{#set: consumed or produced by=3PGAREARR-RXN|2PGADEHYDRAT-RXN|RXN-15513|RXN-15510}} |
Revision as of 11:13, 18 January 2018
Contents
Metabolite 2-PG
- smiles:
- C(=O)([O-])C(OP(=O)([O-])[O-])CO
- inchi key:
- InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K
- common name:
- 2-phospho-D-glycerate
- molecular weight:
- 183.034
- Synonym(s):
- 2-phospho-(D)-glycerate
- 2-phospho-(R)-glycerate
- 2-phospho-D-glyceric acid
- 2-P-D-glycerate
- D-Glycerate 2-phosphate
- D-2-phosphoglycerate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 2553-59-5
- METABOLIGHTS : MTBLC58289
- PUBCHEM:
- HMDB : HMDB03391
- LIGAND-CPD:
- CHEBI:
- BIGG : 2pg
"C(=O)([O-])C(OP(=O)([O-])[O-])CO" cannot be used as a page name in this wiki.