Difference between revisions of "CHC T00002289001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18780 CPD-18780] == * smiles: ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) * inchi key: ** InChIKey=JC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2562 RXN-2562] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18780 CPD-18780] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2562 RXN-2562] ==
−
* smiles:
+
* direction:
−
** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=JCZFNXYQGNLHDQ-JWXFUTCRSA-N
+
** [http://enzyme.expasy.org/EC/2.1.1.95 EC-2.1.1.95]
−
* common name:
+
−
** 2-epi-valiolone
+
−
* molecular weight:
+
−
** 192.168   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-17373]]
+
** 1 [[DELTA-TOCOPHEROL]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[BETA-TOCOPHEROL]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 δ-tocopherol[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 H+[c] '''+''' 1 β-tocopherol[c] '''+''' 1 S-adenosyl-L-homocysteine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00000837001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
** [[pantograph]]-[[a.taliana]]
 +
== Pathways  ==
 +
* [[PWY-1422]], vitamin E biosynthesis (tocopherols): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1422 PWY-1422]
 +
** '''5''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 +
*** [[a.taliana]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=JCZFNXYQGNLHDQ-JWXFUTCRSA-N}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R07504 R07504]
−
{{#set: common name=2-epi-valiolone}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=192.168    }}
+
{{#set: ec number=EC-2.1.1.95}}
−
{{#set: common name=(2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one}}
+
{{#set: gene associated=CHC_T00000837001_1}}
−
{{#set: produced by=RXN-17373}}
+
{{#set: in pathway=PWY-1422}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction tool=pantograph}}
 +
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}

Revision as of 11:13, 18 January 2018

Reaction RXN-2562

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-1422, vitamin E biosynthesis (tocopherols): PWY-1422
    • 5 reactions found over 7 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00002289001_1&oldid=7014"