Difference between revisions of "CHC T00004542001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_GTP TransportSeed_GTP] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Fo...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * smiles: ** C1(=CC(=O)OC(=CC(=O)[O-])1) * inchi key: ** InChIKey=AYFXP...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_GTP TransportSeed_GTP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(=CC(=O)OC(=CC(=O)[O-])1)
 +
* inchi key:
 +
** InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M
 +
* common name:
 +
** trans-dienelactone
 +
* molecular weight:
 +
** 139.087   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-trans-dienelactone
 +
** trans-4-carboxymethylenebut-2-en-1,4-olide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-9868]]
−
** 1.0 [[GTP]][e] '''=>''' 1.0 [[GTP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 GTP[e] '''=>''' 1.0 GTP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[manual]]:
+
−
** [[added to manage seeds from extracellular to cytosol compartment]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543248 9543248]
−
{{#set: reconstruction category=manual}}
+
* CHEMSPIDER:
−
{{#set: reconstruction source=added to manage seeds from extracellular to cytosol compartment}}
+
** [http://www.chemspider.com/Chemical-Structure.7822189.html 7822189]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C12838 C12838]
 +
{{#set: smiles=C1(=CC(=O)OC(=CC(=O)[O-])1)}}
 +
{{#set: inchi key=InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M}}
 +
{{#set: common name=trans-dienelactone}}
 +
{{#set: molecular weight=139.087    }}
 +
{{#set: common name=2-trans-dienelactone|trans-4-carboxymethylenebut-2-en-1,4-olide}}
 +
{{#set: consumed by=RXN-9868}}

Revision as of 12:13, 18 January 2018

Metabolite CPD-10608

  • smiles:
    • C1(=CC(=O)OC(=CC(=O)[O-])1)
  • inchi key:
    • InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M
  • common name:
    • trans-dienelactone
  • molecular weight:
    • 139.087
  • Synonym(s):
    • 2-trans-dienelactone
    • trans-4-carboxymethylenebut-2-en-1,4-olide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(=CC(=O)OC(=CC(=O)[O-])1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00004542001_1&oldid=7039"