Difference between revisions of "PWY-5530"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10793 CPD-10793] == * smiles: ** [CH](=O)C(=O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=NZ...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6372 PWY-6372] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33083 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6372 PWY-6372] == |
− | * | + | * taxonomic range: |
− | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33083 TAX-33083] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** lipid-independent phytic acid biosynthesis |
+ | ** lipid-independent InsP6 biosynthesis | ||
+ | ** lipid-independent phytate biosynthesis | ||
+ | ** 1D-myo-inositol hexakisphosphate biosynthesis (lipid-independent) | ||
+ | ** phytate biosynthesis | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''1''' reaction(s) found |
− | == Reaction(s) | + | ** [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]] |
− | + | == Reaction(s) not found == | |
+ | * '''6''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.140-RXN 2.7.1.140-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7163 RXN-7163] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL-1-KINASE-RXN MYO-INOSITOL-1-KINASE-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-10982 RXN-10982] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-10983 RXN-10983] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-10984 RXN-10984] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33083}} | |
− | + | {{#set: common name=1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium)}} | |
− | + | {{#set: common name=lipid-independent phytic acid biosynthesis|lipid-independent InsP6 biosynthesis|lipid-independent phytate biosynthesis|1D-myo-inositol hexakisphosphate biosynthesis (lipid-independent)|phytate biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=6}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 11:14, 18 January 2018
Pathway PWY-6372
- taxonomic range:
- common name:
- 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium)
- Synonym(s):
- lipid-independent phytic acid biosynthesis
- lipid-independent InsP6 biosynthesis
- lipid-independent phytate biosynthesis
- 1D-myo-inositol hexakisphosphate biosynthesis (lipid-independent)
- phytate biosynthesis
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 6 reaction(s) not found