Difference between revisions of "PWY-5530"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10793 CPD-10793] == * smiles: ** [CH](=O)C(=O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=NZ...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6372 PWY-6372] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33083 TAX-3...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10793 CPD-10793] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6372 PWY-6372] ==
* smiles:
+
* taxonomic range:
** [CH](=O)C(=O)COP(=O)([O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33083 TAX-33083]
* inchi key:
+
** InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
** hydroxypyruvaldehyde phosphate
+
** 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium)
* molecular weight:
+
** 166.027   
+
 
* Synonym(s):
 
* Synonym(s):
** 2,3-dioxopropyl dihydrogen phosphate
+
** lipid-independent phytic acid biosynthesis
 +
** lipid-independent InsP6 biosynthesis
 +
** lipid-independent phytate biosynthesis
 +
** 1D-myo-inositol hexakisphosphate biosynthesis (lipid-independent)
 +
** phytate biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17808]]
+
* '''1''' reaction(s) found
== Reaction(s) known to produce the compound ==
+
** [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''6''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.140-RXN 2.7.1.140-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7163 RXN-7163]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL-1-KINASE-RXN MYO-INOSITOL-1-KINASE-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-10982 RXN-10982]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-10983 RXN-10983]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-10984 RXN-10984]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-33083}}
** [http://www.genome.jp/dbget-bin/www_bget?C16849 C16849]
+
{{#set: common name=1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium)}}
* CHEMSPIDER:
+
{{#set: common name=lipid-independent phytic acid biosynthesis|lipid-independent InsP6 biosynthesis|lipid-independent phytate biosynthesis|1D-myo-inositol hexakisphosphate biosynthesis (lipid-independent)|phytate biosynthesis}}
** [http://www.chemspider.com/Chemical-Structure.19993665.html 19993665]
+
{{#set: reaction found=1}}
* CHEBI:
+
{{#set: reaction not found=6}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58860 58860]
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21126161 21126161]
+
{{#set: smiles=[CH](=O)C(=O)COP(=O)([O-])[O-]}}
+
{{#set: inchi key=InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L}}
+
{{#set: common name=hydroxypyruvaldehyde phosphate}}
+
{{#set: molecular weight=166.027    }}
+
{{#set: common name=2,3-dioxopropyl dihydrogen phosphate}}
+
{{#set: consumed by=RXN-17808}}
+

Revision as of 11:14, 18 January 2018

Pathway PWY-6372

  • taxonomic range:
  • common name:
    • 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium)
  • Synonym(s):
    • lipid-independent phytic acid biosynthesis
    • lipid-independent InsP6 biosynthesis
    • lipid-independent phytate biosynthesis
    • 1D-myo-inositol hexakisphosphate biosynthesis (lipid-independent)
    • phytate biosynthesis

Reaction(s) found

Reaction(s) not found

External links