Difference between revisions of "RXN-9003"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17753 RXN-17753] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17753 RXN-17753] ==
* smiles:
+
* direction:
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
+
* common name:
+
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
+
* molecular weight:
+
** 442.724   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-13]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CARBAMOYL-P]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[CPD-69]][c]
* [[RXN66-12]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 carbamoyl phosphate[c] '''=>''' 1 H+[c] '''+''' 1 phosphate[c] '''+''' 1 cyanate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[original_genome]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698824 15698824]
+
{{#set: in pathway=}}
* CHEBI:
+
{{#set: reconstruction category=annotation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87060 87060]
+
{{#set: reconstruction tool=pathwaytools}}
* HMDB : HMDB12159
+
{{#set: reconstruction source=original_genome}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
+
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=442.724    }}
+
{{#set: consumed by=RXN66-13}}
+
{{#set: produced by=RXN66-12}}
+

Revision as of 12:14, 18 January 2018

Reaction RXN-17753

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 carbamoyl phosphate[c] => 1 H+[c] + 1 phosphate[c] + 1 cyanate[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links