Difference between revisions of "CHC T00006708001 1"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009343001_1 == * Synonym(s): == Reactions associated == * ADENOSYLHOMOCYSTEINASE-RXN ** pantograph-galdieria.sulphuraria ** pan...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14646 CPD-14646] == * smiles: ** CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14646 CPD-14646] == |
+ | * smiles: | ||
+ | ** CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C | ||
+ | * common name: | ||
+ | ** 9-cis-β-carotene | ||
+ | * inchi key: | ||
+ | ** InChIKey=OENHQHLEOONYIE-BVZAMQQESA-N | ||
+ | * molecular weight: | ||
+ | ** 536.882 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-13641]] | |
− | == | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C20484 C20484] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67188 67188] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9828626 9828626] | ||
+ | {{#set: smiles=CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C}} | ||
+ | {{#set: common name=9-cis-β-carotene}} | ||
+ | {{#set: inchi key=InChIKey=OENHQHLEOONYIE-BVZAMQQESA-N}} | ||
+ | {{#set: molecular weight=536.882 }} | ||
+ | {{#set: consumed or produced by=RXN-13641}} |
Revision as of 11:14, 18 January 2018
Contents
Metabolite CPD-14646
- smiles:
- CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C
- common name:
- 9-cis-β-carotene
- inchi key:
- InChIKey=OENHQHLEOONYIE-BVZAMQQESA-N
- molecular weight:
- 536.882
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links