Difference between revisions of "PWY-4081"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4984 PWY-4984] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4984 PWY-4984] ==
−
* smiles:
+
* taxonomic range:
−
** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
+
 
* common name:
 
* common name:
−
** delphinidin 3,5-di-O-β-D-glucoside
+
** urea cycle
−
* molecular weight:
+
−
** 626.524   
+
 
* Synonym(s):
 
* Synonym(s):
−
** delphinidin-3,5-diglucoside
+
** Krebs ornithine cycle
 +
** Krebs-Henseleit cycle
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
* '''5''' reaction(s) found
−
* [[RXN-8228]]
+
** [[ARGSUCCINLYA-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** [[ARGINASE-RXN]]
 +
** [[ARGSUCCINSYN-RXN]]
 +
** [[RXN-13202]]
 +
** [[ORNCARBAMTRANSFER-RXN]]
 +
== Reaction(s) not found ==
 +
* '''0''' reaction(s) not found
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201902 25201902]
+
{{#set: taxonomic range=TAX-2759}}
−
* CHEBI:
+
{{#set: common name=urea cycle}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77838 77838]
+
{{#set: common name=Krebs ornithine cycle|Krebs-Henseleit cycle}}
−
* LIGAND-CPD:
+
{{#set: reaction found=5}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16312 C16312]
+
{{#set: reaction not found=0}}
−
* HMDB : HMDB30693
+
−
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))}}
+
−
{{#set: inchi key=InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N}}
+
−
{{#set: common name=delphinidin 3,5-di-O-β-D-glucoside}}
+
−
{{#set: molecular weight=626.524    }}
+
−
{{#set: common name=delphinidin-3,5-diglucoside}}
+
−
{{#set: produced by=RXN-8228}}
+

Revision as of 10:47, 18 January 2018

Pathway PWY-4984

  • taxonomic range:
  • common name:
    • urea cycle
  • Synonym(s):
    • Krebs ornithine cycle
    • Krebs-Henseleit cycle

Reaction(s) found

Reaction(s) not found

  • 0 reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-4081&oldid=4685"