Difference between revisions of "PYRIDNUCSAL-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-3-HYDROXYACYL-COA D-3-HYDROXYACYL-COA] == * common name: ** a (3R)-3-hydroxyacyl-CoA * Synony...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18777 CPD-18777] == * smiles: ** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1) * common name: ** my...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18777 CPD-18777] == |
+ | * smiles: | ||
+ | ** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1) | ||
* common name: | * common name: | ||
− | ** | + | ** mycosporine glycine |
+ | * inchi key: | ||
+ | ** InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M | ||
+ | * molecular weight: | ||
+ | ** 244.224 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-17368]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | + | * [[RXN-17371]] | |
− | * [[RXN- | + | |
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)}} |
− | {{#set: common name= | + | {{#set: common name=mycosporine glycine}} |
− | {{#set: consumed or produced by= | + | {{#set: inchi key=InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M}} |
+ | {{#set: molecular weight=244.224 }} | ||
+ | {{#set: produced by=RXN-17368}} | ||
+ | {{#set: consumed or produced by=RXN-17371}} |
Revision as of 11:15, 18 January 2018
Contents
Metabolite CPD-18777
- smiles:
- COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)
- common name:
- mycosporine glycine
- inchi key:
- InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M
- molecular weight:
- 244.224
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)" cannot be used as a page name in this wiki.