Difference between revisions of "Methylated-Ribosomal-Protein-L11s"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15199 CPD-15199] == * smiles: ** CC1(OC(C(C1O)O)OP([O-])([O-])=O) * inchi key: ** InChIKey=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-218 RXN3O-218] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15199 CPD-15199] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-218 RXN3O-218] ==
−
* smiles:
+
* direction:
−
** CC1(OC(C(C1O)O)OP([O-])([O-])=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L
+
** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20]
−
* common name:
+
−
** 5-deoxy-α-ribose 1-phosphate
+
−
* molecular weight:
+
−
** 212.096   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 2 [[FERROCYTOCHROME-B5]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[EPISTEROL]][c] '''=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c] '''+''' 1 [[CPD-700]][c]
−
* [[RXN-14304]]
+
* With common name(s):
 +
** 2 a ferrocytochrome b5[c] '''+''' 2 H+[c] '''+''' 1 oxygen[c] '''+''' 1 episterol[c] '''=>''' 2 a ferricytochrome b5[c] '''+''' 2 H2O[c] '''+''' 1 ergosta-5,7,24(28)-trien-3β-ol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00006481001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
** [[pantograph]]-[[a.taliana]]
 +
== Pathways  ==
 +
* [[PWY-6075]], ergosterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6075 PWY-6075]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541]
 +
** '''7''' reactions found over '''36''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 +
*** [[a.taliana]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=51351655 51351655]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33463 33463]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58749 58749]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07505 R07505]
−
{{#set: smiles=CC1(OC(C(C1O)O)OP([O-])([O-])=O)}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R07491 R07491]
−
{{#set: inchi key=InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: common name=5-deoxy-α-ribose 1-phosphate}}
+
{{#set: ec number=EC-1.14.19.20}}
−
{{#set: molecular weight=212.096    }}
+
{{#set: gene associated=CHC_T00006481001_1}}
−
{{#set: consumed or produced by=RXN-14304}}
+
{{#set: in pathway=PWY-6075|PWY-2541}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction tool=pantograph}}
 +
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}

Revision as of 11:16, 18 January 2018

Reaction RXN3O-218

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6075, ergosterol biosynthesis I: PWY-6075
    • 2 reactions found over 5 reactions in the full pathway
  • PWY-2541, plant sterol biosynthesis: PWY-2541
    • 7 reactions found over 36 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=Methylated-Ribosomal-Protein-L11s&oldid=7240"