Difference between revisions of "CHC T00005083001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16623 RXN-16623] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] == * smiles: ** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16623 RXN-16623] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
+
** InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J
 +
* common name:
 +
** (2E,7Z)-tetradecenoyl-CoA
 +
* molecular weight:
 +
** 969.83   
 
* Synonym(s):
 
* Synonym(s):
 +
** 14:2-Δ2,Δ7-CoA
 +
** 2-trans,7-cis-tetradecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-17793]]
−
** 1 [[3R-7Z-3-hydroxy-hexadec-7-enoyl-ACPs]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[2E-7Z-hexadeca-2-7-dienoyl-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-17792]]
−
** 1 a (3R,7Z)-3-hydroxy-hexadec-7-enoyl-[acp][c] '''=>''' 1 H2O[c] '''+''' 1 a (2E,7Z)-hexadeca-2,7-dienoyl-[acp][c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7664]], oleate biosynthesis IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664]
+
−
** '''14''' reactions found over '''14''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[gap-filling]]:
+
−
** [[meneco]]:
+
−
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: ec number=EC-4.2.1.59}}
+
{{#set: inchi key=InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J}}
−
{{#set: in pathway=PWY-7664}}
+
{{#set: common name=(2E,7Z)-tetradecenoyl-CoA}}
−
{{#set: reconstruction category=gap-filling}}
+
{{#set: molecular weight=969.83    }}
−
{{#set: reconstruction tool=meneco}}
+
{{#set: common name=14:2-Δ2,Δ7-CoA|2-trans,7-cis-tetradecenoyl-CoA}}
−
{{#set: reconstruction source=added for gapfilling}}
+
{{#set: consumed by=RXN-17793}}
 +
{{#set: produced by=RXN-17792}}

Revision as of 11:16, 18 January 2018

Metabolite CPD-19161

  • smiles:
    • CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J
  • common name:
    • (2E,7Z)-tetradecenoyl-CoA
  • molecular weight:
    • 969.83
  • Synonym(s):
    • 14:2-Δ2,Δ7-CoA
    • 2-trans,7-cis-tetradecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00005083001_1&oldid=7243"