Difference between revisions of "CPD-9865"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == * smiles: ** C1(NC2(C(C=1CC(=O)OC)=CC=CC=2)) * inchi key: ** InChIKey=K...") |
(Created page with "Category:Gene == Gene CHC_T00008380001 == * left end position: ** 4374 * transcription direction: ** NEGATIVE * right end position: ** 6080 * centisome position: ** 8.0005...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008380001 == |
− | * | + | * left end position: |
− | ** | + | ** 4374 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 6080 |
− | * | + | * centisome position: |
− | ** | + | ** 8.000586 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]] |
− | + | ** original_genome | |
− | == | + | ***automated-name-match |
+ | * [[RXN66-579]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-2301]] | ||
+ | * [[PWY-4661]] | ||
+ | * [[PWY-6580]] | ||
+ | * [[PWY-6664]] | ||
+ | * [[PWY1G-0]] | ||
+ | * [[PWY-6372]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4374}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=6080}} | |
− | + | {{#set: centisome position=8.000586 }} | |
− | + | {{#set: reaction associated=MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN|RXN66-579}} | |
− | + | {{#set: pathway associated=PWY-2301|PWY-4661|PWY-6580|PWY-6664|PWY1G-0|PWY-6372}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 12:17, 18 January 2018
Gene CHC_T00008380001
- left end position:
- 4374
- transcription direction:
- NEGATIVE
- right end position:
- 6080
- centisome position:
- 8.000586
- Synonym(s):
Reactions associated
- MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN
- original_genome
- automated-name-match
- original_genome
- RXN66-579
- original_genome
- automated-name-match
- original_genome