Difference between revisions of "K-HEXANOYL-COA"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=KDOSYN-PWY KDOSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 T...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13694 CPD-13694] == * smiles: ** CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13694 CPD-13694] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67)))) |
− | + | * inchi key: | |
− | ** | + | ** InChIKey=LPAPCIXIEIQRQA-OQRFGCRRSA-J |
* common name: | * common name: | ||
− | ** | + | ** 24-hydroxy-3-oxocholest-4-en-26-oyl-CoA |
+ | * molecular weight: | ||
+ | ** 1176.114 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** cholest-4-en-24-ol-3-one-26-oyl-CoA | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-12705]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | |
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658714 90658714] |
− | {{#set: | + | {{#set: smiles=CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=LPAPCIXIEIQRQA-OQRFGCRRSA-J}} |
− | {{#set: | + | {{#set: common name=24-hydroxy-3-oxocholest-4-en-26-oyl-CoA}} |
− | {{#set: | + | {{#set: molecular weight=1176.114 }} |
− | {{#set: | + | {{#set: common name=cholest-4-en-24-ol-3-one-26-oyl-CoA}} |
− | {{#set: | + | {{#set: consumed by=RXN-12705}} |
Revision as of 11:17, 18 January 2018
Contents
Metabolite CPD-13694
- smiles:
- CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))
- inchi key:
- InChIKey=LPAPCIXIEIQRQA-OQRFGCRRSA-J
- common name:
- 24-hydroxy-3-oxocholest-4-en-26-oyl-CoA
- molecular weight:
- 1176.114
- Synonym(s):
- cholest-4-en-24-ol-3-one-26-oyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))" cannot be used as a page name in this wiki.