Difference between revisions of "CYSTSYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9546 RXN-9546] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-2,3-stearoyl-CoA-reduct...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOYL-AMP LIPOYL-AMP] == * smiles: ** C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9546 RXN-9546] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOYL-AMP LIPOYL-AMP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)
 +
* inchi key:
 +
** InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M
 
* common name:
 
* common name:
−
** trans-2,3-stearoyl-CoA-reductase (NADPH, B-specific)
+
** lipoyl-adenylate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.1 EC-1.3.1]
+
** 534.518   
 
* Synonym(s):
 
* Synonym(s):
 +
** lipoyl-AMP
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-13039]]
−
** 1 [[CPD-10262]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[STEAROYL-COA]][c] '''+''' 1 [[NADP]][c]
+
* [[RXN-8655]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 trans-octadec-2-enoyl-CoA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 stearoyl-CoA[c] '''+''' 1 NADP+[c]
+
* [[RXN-8654]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008438001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY-5972]], stearate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5972 PWY-5972]
+
−
** '''2''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[a.taliana]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R07761 R07761]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245420 25245420]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=trans-2,3-stearoyl-CoA-reductase (NADPH, B-specific)}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83091 83091]
−
{{#set: ec number=EC-1.3.1}}
+
* LIGAND-CPD:
−
{{#set: gene associated=CHC_T00008438001_1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16238 C16238]
−
{{#set: in pathway=PWY-5972}}
+
* HMDB : HMDB59635
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M}}
−
{{#set: reconstruction source=a.taliana}}
+
{{#set: common name=lipoyl-adenylate}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=534.518    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=lipoyl-AMP}}
−
{{#set: reconstruction source=original_genome}}
+
{{#set: consumed by=RXN-13039|RXN-8655}}
 +
{{#set: produced by=RXN-8654}}

Revision as of 11:48, 18 January 2018

Metabolite LIPOYL-AMP

  • smiles:
    • C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)
  • inchi key:
    • InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M
  • common name:
    • lipoyl-adenylate
  • molecular weight:
    • 534.518
  • Synonym(s):
    • lipoyl-AMP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CYSTSYN-PWY&oldid=4725"