Difference between revisions of "THR-tRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N(C)2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene CHC_1170 == * left end position: ** 176607 * transcription direction: ** NEGATIVE * right end position: ** 176861 * common name: ** psbE * centisome...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_1170 == |
− | * | + | * left end position: |
− | ** | + | ** 176607 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
+ | * right end position: | ||
+ | ** 176861 | ||
* common name: | * common name: | ||
− | ** | + | ** psbE |
− | * | + | * centisome position: |
− | ** | + | ** 98.068146 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[PSII-RXN]] | |
− | * [[ | + | ** original_genome |
− | == | + | ***automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-101]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=176607}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=176861}} | |
− | + | {{#set: common name=psbE}} | |
− | + | {{#set: centisome position=98.068146 }} | |
− | + | {{#set: reaction associated=PSII-RXN}} | |
− | + | {{#set: pathway associated=PWY-101}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:48, 18 January 2018
Gene CHC_1170
- left end position:
- 176607
- transcription direction:
- NEGATIVE
- right end position:
- 176861
- common name:
- psbE
- centisome position:
- 98.068146
- Synonym(s):
Reactions associated
- PSII-RXN
- original_genome
- automated-name-match
- original_genome