Difference between revisions of "CPD-9039"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18390 CPD-18390] == * smiles: ** CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])OC(CCCCCCCCCCCCC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] == * smiles: ** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N |
* common name: | * common name: | ||
− | ** | + | ** 15,9'-di-cis-phytofluene |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 542.93 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-12244]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12243]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19765 C19765] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61990 61990] |
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=51351778 51351778] |
− | {{#set: common name= | + | {{#set: smiles=CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N}} |
− | {{#set: | + | {{#set: common name=15,9'-di-cis-phytofluene}} |
+ | {{#set: molecular weight=542.93 }} | ||
+ | {{#set: consumed by=RXN-12244}} | ||
+ | {{#set: produced by=RXN-12243}} |
Revision as of 12:21, 18 January 2018
Contents
Metabolite CPD-13171
- smiles:
- CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N
- common name:
- 15,9'-di-cis-phytofluene
- molecular weight:
- 542.93
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links