Difference between revisions of "PWY-5744"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12693 RXN-12693] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12693 RXN-12693] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.1.1.145 EC-1.1.1.145]
+
** InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M
 +
* common name:
 +
** shikimate
 +
* molecular weight:
 +
** 173.145  
 
* Synonym(s):
 
* Synonym(s):
 +
** shikimic acid
 +
** (3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7968]]
−
** 1 [[CHOLESTEROL]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-13684]][c] '''+''' 1 [[NADH]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
−
** 1 cholesterol[c] '''+''' 1 NAD+[c] '''=>''' 1 H+[c] '''+''' 1 cholest-5-en-3-one[c] '''+''' 1 NADH[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[SHIKIMATE-KINASE-RXN]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00007359001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-6946]], cholesterol degradation to androstenedione II (cholesterol dehydrogenase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6946 PWY-6946]
+
−
** '''3''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 138-59-0
−
{{#set: ec number=EC-1.1.1.145}}
+
* PUBCHEM:
−
{{#set: gene associated=CHC_T00007359001_1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7057976 7057976]
−
{{#set: in pathway=PWY-6946}}
+
* HMDB : HMDB03070
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00493 C00493]
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.5414360.html 5414360]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36208 36208]
 +
* BIGG : skm
 +
{{#set: smiles=C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])}}
 +
{{#set: inchi key=InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M}}
 +
{{#set: common name=shikimate}}
 +
{{#set: molecular weight=173.145    }}
 +
{{#set: common name=shikimic acid|(3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate}}
 +
{{#set: consumed by=RXN-7968}}
 +
{{#set: produced by=SHIKIMATE-5-DEHYDROGENASE-RXN}}
 +
{{#set: consumed or produced by=SHIKIMATE-KINASE-RXN}}

Revision as of 11:22, 18 January 2018

Metabolite SHIKIMATE

  • smiles:
    • C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])
  • inchi key:
    • InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M
  • common name:
    • shikimate
  • molecular weight:
    • 173.145
  • Synonym(s):
    • shikimic acid
    • (3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-5744&oldid=7746"