Difference between revisions of "RXN-15043"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * smiles: ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2941 PWY-2941] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2941 PWY-2941] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** L-lysine biosynthesis II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | * '''6''' reaction(s) found |
− | + | ** [[RXN-14014]] | |
− | * [ | + | ** [[DIAMINOPIMEPIM-RXN]] |
+ | ** [[DIHYDRODIPICSYN-RXN]] | ||
+ | ** [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | ||
+ | ** [[ASPARTATEKIN-RXN]] | ||
+ | ** [[DIAMINOPIMDECARB-RXN]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''3''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYLDIAMINOPIMELATE-DEACETYLASE-RXN N-ACETYLDIAMINOPIMELATE-DEACETYLASE-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.89-RXN 2.3.1.89-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-4822 RXN-4822] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: common name=L-lysine biosynthesis II}} | |
− | {{#set: | + | {{#set: reaction found=6}} |
− | + | {{#set: reaction not found=3}} | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:48, 18 January 2018
Pathway PWY-2941
- taxonomic range:
- common name:
- L-lysine biosynthesis II
- Synonym(s):
Reaction(s) found
- 6 reaction(s) found
Reaction(s) not found
- 3 reaction(s) not found