Difference between revisions of "PWY0-1545"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00006799001_1 == * Synonym(s): == Reactions associated == * 2.7.1.68-RXN ** pantograph-a.taliana == Pathways associated == * PWY-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * smiles: ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == |
+ | * smiles: | ||
+ | ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** pregn-5-ene-3,20-dione-17-ol | ||
+ | * molecular weight: | ||
+ | ** 330.466 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[RXN66-350]] |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14562950 14562950] |
+ | {{#set: smiles=CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))}} | ||
+ | {{#set: inchi key=InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=pregn-5-ene-3,20-dione-17-ol}} | ||
+ | {{#set: molecular weight=330.466 }} | ||
+ | {{#set: consumed or produced by=RXN66-350}} |
Revision as of 10:48, 18 January 2018
Contents
Metabolite CPD66-27
- smiles:
- CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))
- inchi key:
- InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N
- common name:
- pregn-5-ene-3,20-dione-17-ol
- molecular weight:
- 330.466
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: