Difference between revisions of "2.5.1.41-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5921 PWY-5921] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12218 CPD-12218] == * smiles: ** C(CC(O)C1(=CC=CC=C1))([O-])=O * common name: ** 3-hydroxy-...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5921 PWY-5921] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12218 CPD-12218] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** C(CC(O)C1(=CC=CC=C1))([O-])=O
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
 
* common name:
 
* common name:
−
** glutaminyl-tRNAgln biosynthesis via transamidation
+
** 3-hydroxy-3-phenylpropanoate
 +
* inchi key:
 +
** InChIKey=AYOLELPCNDVZKZ-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 165.168   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-hydroxy-3-phenyl propionic acid
 +
** 3-hydroxy-3-phenylpropionate
 +
** beta-hydroxyphenylpropionic acid
 +
** 3-hydroxy-3-phenylpropanoic acid
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
* '''2''' reaction(s) found
+
* [[RXN-11270]]
−
** [[RXN-9386]]
+
== Reaction(s) known to produce the compound ==
−
** [[6.3.5.7-RXN]]
+
* [[RXN-11269]]
−
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
−
* '''0''' reaction(s) not found
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2759}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22328018 22328018]
−
{{#set: taxonomic range=TAX-2157}}
+
* CHEMSPIDER:
−
{{#set: common name=glutaminyl-tRNAgln biosynthesis via transamidation}}
+
** [http://www.chemspider.com/Chemical-Structure.11347248.html 11347248]
−
{{#set: reaction found=2}}
+
* CHEBI:
−
{{#set: reaction not found=0}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63469 63469]
 +
{{#set: smiles=C(CC(O)C1(=CC=CC=C1))([O-])=O}}
 +
{{#set: common name=3-hydroxy-3-phenylpropanoate}}
 +
{{#set: inchi key=InChIKey=AYOLELPCNDVZKZ-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=165.168    }}
 +
{{#set: common name=3-hydroxy-3-phenyl propionic acid|3-hydroxy-3-phenylpropionate|beta-hydroxyphenylpropionic acid|3-hydroxy-3-phenylpropanoic acid}}
 +
{{#set: consumed by=RXN-11270}}
 +
{{#set: produced by=RXN-11269}}

Revision as of 11:23, 18 January 2018

Metabolite CPD-12218

  • smiles:
    • C(CC(O)C1(=CC=CC=C1))([O-])=O
  • common name:
    • 3-hydroxy-3-phenylpropanoate
  • inchi key:
    • InChIKey=AYOLELPCNDVZKZ-UHFFFAOYSA-M
  • molecular weight:
    • 165.168
  • Synonym(s):
    • 3-hydroxy-3-phenyl propionic acid
    • 3-hydroxy-3-phenylpropionate
    • beta-hydroxyphenylpropionic acid
    • 3-hydroxy-3-phenylpropanoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC(O)C1(=CC=CC=C1))([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=2.5.1.41-RXN&oldid=7865"