Difference between revisions of "Oxo-glutarate-dehydrogenase-lipoyl"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-2544 RXN1G-2544] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-cyclopropane-Δ1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-2544 RXN1G-2544] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase |
− | * | + | ** Cyclopropane-fatty-acyl-phospholipid synthase family |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.1.1.79 EC-2.1.1.79] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[cis-D19-37-MOH-38-Me-C57-1-ACPs]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[cis-19-CP-37-Mex-38-Me-C59-ACPs]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 S-adenosyl-L-methionine[c] '''+''' 1 a cis-delta19-37-methoxy-38-methyl-C57:1-[acp][c] '''=>''' 1 H+[c] '''+''' 1 a cis-methoxy-C59-meroacyl-[acp][c] '''+''' 1 S-adenosyl-L-homocysteine[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[CHC_T00005488001_1]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | * [[CHC_T00009019001]] | ||
+ | ** ORIGINAL_GENOME | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | * [[CHC_T00003092001_1]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
+ | ** '''29''' reactions found over '''182''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[galdieria.sulphuraria]] | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[original_genome]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase}} | |
− | {{#set: | + | {{#set: common name=Cyclopropane-fatty-acyl-phospholipid synthase family}} |
− | {{#set: | + | {{#set: ec number=EC-2.1.1.79}} |
− | {{#set: | + | {{#set: gene associated=CHC_T00005488001_1|CHC_T00009019001|CHC_T00003092001_1}} |
− | {{#set: | + | {{#set: in pathway=PWYG-321}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | {{#set: reconstruction source=galdieria.sulphuraria}} |
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} | ||
+ | {{#set: reconstruction source=original_genome}} |
Revision as of 12:25, 18 January 2018
Contents
Reaction RXN1G-2544
- direction:
- LEFT-TO-RIGHT
- common name:
- cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase
- Cyclopropane-fatty-acyl-phospholipid synthase family
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 S-ADENOSYLMETHIONINE[c] + 1 cis-D19-37-MOH-38-Me-C57-1-ACPs[c] => 1 PROTON[c] + 1 cis-19-CP-37-Mex-38-Me-C59-ACPs[c] + 1 ADENOSYL-HOMO-CYS[c]
- With common name(s):
- 1 S-adenosyl-L-methionine[c] + 1 a cis-delta19-37-methoxy-38-methyl-C57:1-[acp][c] => 1 H+[c] + 1 a cis-methoxy-C59-meroacyl-[acp][c] + 1 S-adenosyl-L-homocysteine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- CHC_T00005488001_1
- CHC_T00009019001
- ORIGINAL_GENOME
- AUTOMATED-NAME-MATCH
- ORIGINAL_GENOME
- CHC_T00003092001_1
Pathways
Reconstruction information
External links
"cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase" cannot be used as a page name in this wiki.