Difference between revisions of "RXN1G-2544"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12218 CPD-12218] == * smiles: ** C(CC(O)C1(=CC=CC=C1))([O-])=O * common name: ** 3-hydroxy-...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13445 RXN-13445] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12218 CPD-12218] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13445 RXN-13445] ==
−
* smiles:
+
* direction:
−
** C(CC(O)C1(=CC=CC=C1))([O-])=O
+
** LEFT-TO-RIGHT
−
* common name:
+
* ec number:
−
** 3-hydroxy-3-phenylpropanoate
+
** [http://enzyme.expasy.org/EC/1.3.1.93 EC-1.3.1.93]
−
* inchi key:
+
−
** InChIKey=AYOLELPCNDVZKZ-UHFFFAOYSA-M
+
−
* molecular weight:
+
−
** 165.168   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxy-3-phenyl propionic acid
 
−
** 3-hydroxy-3-phenylpropionate
 
−
** beta-hydroxyphenylpropionic acid
 
−
** 3-hydroxy-3-phenylpropanoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11270]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-14425]][c] '''+''' 1 [[Donor-H2]][c] '''=>''' 1 [[Acceptor]][c] '''+''' 1 [[CPD-14426]][c]
−
* [[RXN-11269]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 (2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA[c] '''+''' 1 a reduced electron acceptor[c] '''=>''' 1 an oxidized electron acceptor[c] '''+''' 1 docosapentaenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00000701001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00004718001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00001951001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00001929001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00003552001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00005019001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00006026001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00006926001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00000757001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-7053]], docosahexaenoate biosynthesis I (lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7053 PWY-7053]
 +
** '''3''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-7606]], docosahexaenoate biosynthesis III (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606]
 +
** '''6''' reactions found over '''14''' reactions in the full pathway
 +
* [[PWY-7727]], docosahexaenoate biosynthesis IV (4-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7727 PWY-7727]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22328018 22328018]
+
{{#set: ec number=EC-1.3.1.93}}
−
* CHEMSPIDER:
+
{{#set: gene associated=CHC_T00000701001_1|CHC_T00004718001_1|CHC_T00001951001_1|CHC_T00001929001_1|CHC_T00003552001_1|CHC_T00005019001_1|CHC_T00006026001_1|CHC_T00006926001_1|CHC_T00000757001_1}}
−
** [http://www.chemspider.com/Chemical-Structure.11347248.html 11347248]
+
{{#set: in pathway=PWY-7053|PWY-7606|PWY-7727}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63469 63469]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C(CC(O)C1(=CC=CC=C1))([O-])=O}}
+
{{#set: reconstruction source=galdieria.sulphuraria}}
−
{{#set: common name=3-hydroxy-3-phenylpropanoate}}
+
−
{{#set: inchi key=InChIKey=AYOLELPCNDVZKZ-UHFFFAOYSA-M}}
+
−
{{#set: molecular weight=165.168    }}
+
−
{{#set: common name=3-hydroxy-3-phenyl propionic acid|3-hydroxy-3-phenylpropionate|beta-hydroxyphenylpropionic acid|3-hydroxy-3-phenylpropanoic acid}}
+
−
{{#set: consumed by=RXN-11270}}
+
−
{{#set: produced by=RXN-11269}}
+

Revision as of 11:25, 18 January 2018

Reaction RXN-13445

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA[c] + 1 a reduced electron acceptor[c] => 1 an oxidized electron acceptor[c] + 1 docosapentaenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7053, docosahexaenoate biosynthesis I (lower eukaryotes): PWY-7053
    • 3 reactions found over 7 reactions in the full pathway
  • PWY-7606, docosahexaenoate biosynthesis III (6-desaturase, mammals): PWY-7606
    • 6 reactions found over 14 reactions in the full pathway
  • PWY-7727, docosahexaenoate biosynthesis IV (4-desaturase, mammals): PWY-7727
    • 3 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN1G-2544&oldid=8006"