Difference between revisions of "RXN-7163"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356] ==
−
* smiles:
+
* taxonomic range:
−
** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
** InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-(11Z)-octadecenoyl-CoA
+
** thiamine salvage IV (yeast)
−
* molecular weight:
+
−
** 1041.936   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-18:1-Δ11-CoA
+
** thiamin salvage IV (yeast)
−
** 3-oxo-11-cis-octadecenoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-17787]]
+
* '''4''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[PYRIMSYN3-RXN]]
−
* [[RXN-17786]]
+
** [[THI-P-SYN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** [[THIAZOLSYN3-RXN]]
 +
** [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 +
== Reaction(s) not found ==
 +
* '''3''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=THIAMINASE-RXN THIAMINASE-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=OHMETPYRKIN-RXN OHMETPYRKIN-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4191 RXNQT-4191]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: inchi key=InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J}}
+
{{#set: taxonomic range=TAX-4751}}
−
{{#set: common name=3-oxo-(11Z)-octadecenoyl-CoA}}
+
{{#set: common name=thiamine salvage IV (yeast)}}
−
{{#set: molecular weight=1041.936    }}
+
{{#set: common name=thiamin salvage IV (yeast)}}
−
{{#set: common name=3-oxo-18:1-Δ11-CoA|3-oxo-11-cis-octadecenoyl-CoA}}
+
{{#set: reaction found=4}}
−
{{#set: consumed by=RXN-17787}}
+
{{#set: reaction not found=3}}
−
{{#set: produced by=RXN-17786}}
+

Revision as of 11:48, 18 January 2018

Pathway PWY-7356

  • taxonomic range:
  • common name:
    • thiamine salvage IV (yeast)
  • Synonym(s):
    • thiamin salvage IV (yeast)

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-7163&oldid=4783"