Difference between revisions of "PMPOXI-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14200 RXN-14200] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1699 CPD0-1699] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2)) * common name: ** 6...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1699 CPD0-1699] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2)) |
| − | * | + | * common name: |
| − | ** | + | ** 6-carboxy-5,6,7,8-tetrahydropterin |
| + | * inchi key: | ||
| + | ** InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M | ||
| + | * molecular weight: | ||
| + | ** 210.172 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 6-carboxytetrahydropterin | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN0-5507]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123380 44123380] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61032 61032] |
| − | {{#set: | + | {{#set: smiles=C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))}} |
| − | {{#set: | + | {{#set: common name=6-carboxy-5,6,7,8-tetrahydropterin}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M}} |
| + | {{#set: molecular weight=210.172 }} | ||
| + | {{#set: common name=6-carboxytetrahydropterin}} | ||
| + | {{#set: produced by=RXN0-5507}} | ||
Revision as of 11:27, 18 January 2018
Contents
Metabolite CPD0-1699
- smiles:
- C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))
- common name:
- 6-carboxy-5,6,7,8-tetrahydropterin
- inchi key:
- InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M
- molecular weight:
- 210.172
- Synonym(s):
- 6-carboxytetrahydropterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))" cannot be used as a page name in this wiki.
