Difference between revisions of "CPD0-2108"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] == * smiles: ** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-]...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-HIS-tRNAs Charged-HIS-tRNAs] == * common name: ** an L-histidyl-[tRNAhis] * Synonym(s):...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-HIS-tRNAs Charged-HIS-tRNAs] ==
* smiles:
+
** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
+
* inchi key:
+
** InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J
+
 
* common name:
 
* common name:
** trans-oct-2-enoyl-CoA
+
** an L-histidyl-[tRNAhis]
* molecular weight:
+
** 887.685   
+
 
* Synonym(s):
 
* Synonym(s):
** (2E)-octenoyl-CoA
 
** trans-2-octenoyl-coenzyme A
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12669]]
+
* [[HISTIDINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=an L-histidyl-[tRNAhis]}}
** [http://www.genome.jp/dbget-bin/www_bget?C05276 C05276]
+
{{#set: produced by=HISTIDINE--TRNA-LIGASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62242 62242]
+
* BIGG : oc2coa
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173358 46173358]
+
* HMDB : HMDB03949
+
{{#set: smiles=CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}}
+
{{#set: inchi key=InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J}}
+
{{#set: common name=trans-oct-2-enoyl-CoA}}
+
{{#set: molecular weight=887.685    }}
+
{{#set: common name=(2E)-octenoyl-CoA|trans-2-octenoyl-coenzyme A}}
+
{{#set: produced by=RXN-12669}}
+

Revision as of 11:27, 18 January 2018

Metabolite Charged-HIS-tRNAs

  • common name:
    • an L-histidyl-[tRNAhis]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an L-histidyl-[tRNAhis" cannot be used as a page name in this wiki.