Difference between revisions of "CHC T00009545001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1101 RXN-1101] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1101 RXN-1101] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.2.1.44 EC-1.2.1.44]
+
** InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
 +
* common name:
 +
** ergosta-5,7,24(28)-trien-3β-ol
 +
* molecular weight:
 +
** 396.655   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5,7,24(28)-ergostatrienol
 +
** 5-dehydro episterol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[P-COUMAROYL-COA]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[COUMARALDEHYDE]][c] '''+''' 1 [[NADP]][c]
+
* [[RXN3O-218]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 4-coumaroyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 4-coumaraldehyde[c] '''+''' 1 NADP+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00009538001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY-361]], phenylpropanoid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-361 PWY-361]
+
−
** '''6''' reactions found over '''15''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* LIGAND-CPD:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01615 R01615]
+
** [http://www.genome.jp/dbget-bin/www_bget?C15780 C15780]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* HMDB : HMDB06848
−
{{#set: ec number=EC-1.2.1.44}}
+
* CHEBI:
−
{{#set: gene associated=CHC_T00009538001_1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52972 52972]
−
{{#set: in pathway=PWY-361}}
+
* PUBCHEM:
−
{{#set: reconstruction category=orthology}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10894570 10894570]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reconstruction source=a.taliana}}
+
{{#set: inchi key=InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N}}
 +
{{#set: common name=ergosta-5,7,24(28)-trien-3β-ol}}
 +
{{#set: molecular weight=396.655    }}
 +
{{#set: common name=5,7,24(28)-ergostatrienol|5-dehydro episterol}}
 +
{{#set: produced by=RXN3O-218}}

Revision as of 10:48, 18 January 2018

Metabolite CPD-700

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
  • common name:
    • ergosta-5,7,24(28)-trien-3β-ol
  • molecular weight:
    • 396.655
  • Synonym(s):
    • 5,7,24(28)-ergostatrienol
    • 5-dehydro episterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00009545001&oldid=4796"