Difference between revisions of "CPD-7524"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == * smiles: ** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3))) * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-423 PWY66-423] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-423 PWY66-423] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** fructose 2,6-bisphosphate biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | * '''2''' reaction(s) found |
| − | == Reaction(s) | + | ** [[6-PHOSPHOFRUCTO-2-KINASE-RXN]] |
| − | + | ** [[3.1.3.46-RXN]] | |
| + | == Reaction(s) not found == | ||
| + | * '''0''' reaction(s) not found | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=fructose 2,6-bisphosphate biosynthesis}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: reaction not found=0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 11:29, 18 January 2018
Pathway PWY66-423
- taxonomic range:
- common name:
- fructose 2,6-bisphosphate biosynthesis
- Synonym(s):
Reaction(s) found
- 2 reaction(s) found
Reaction(s) not found
- 0 reaction(s) not found
