Difference between revisions of "CHC T00003361001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6826 PWY-6826] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6826 PWY-6826] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
 
* common name:
 
* common name:
−
** phosphatidylcholine biosynthesis VI
+
** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
 +
* molecular weight:
 +
** 427.646   
 
* Synonym(s):
 
* Synonym(s):
−
** PCS pathway
 
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
* '''1''' reaction(s) found
+
* [[RXN66-318]]
−
** [[2.7.8.24-RXN]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) not found ==
+
* [[RXN-13709]]
−
* '''0''' reaction(s) not found
+
* [[RXN66-317]]
 +
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
−
{{#set: common name=phosphatidylcholine biosynthesis VI}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659076 90659076]
−
{{#set: common name=PCS pathway}}
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))}}
−
{{#set: reaction found=1}}
+
{{#set: inchi key=InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M}}
−
{{#set: reaction not found=0}}
+
{{#set: common name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}}
 +
{{#set: molecular weight=427.646    }}
 +
{{#set: consumed by=RXN66-318}}
 +
{{#set: produced by=RXN-13709|RXN66-317}}

Revision as of 11:29, 18 January 2018

Metabolite CPD-4702

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
  • inchi key:
    • InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
  • common name:
    • 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
  • molecular weight:
    • 427.646
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00003361001_1&oldid=8357"