Difference between revisions of "PWY-6578"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6854 PWY-6854] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6854 PWY-6854] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** ethylene biosynthesis III (microbes) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''5''' reaction(s) found |
− | + | ** [[RXN-12539]] | |
− | * [[RXN- | + | ** [[SUPEROX-DISMUT-RXN]] |
− | == Reaction(s) | + | ** [[RXN-12540]] |
+ | ** [[RXN-12541]] | ||
+ | ** [[FERRIC-CHELATE-REDUCTASE-RXN]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''2''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-14960 RXN-14960] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=R15-RXN R15-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=ethylene biosynthesis III (microbes)}} | |
− | + | {{#set: reaction found=5}} | |
− | + | {{#set: reaction not found=2}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 11:29, 18 January 2018
Pathway PWY-6854
Reaction(s) found
- 5 reaction(s) found