Difference between revisions of "RXN0-5234"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] == * smiles: ** CCCCCCCCC=CCCCCCCCC([O-])=O * inchi key: ** InChIKey=ZQP...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12203 RXN-12203] == * direction: ** LEFT-TO-RIGHT * common name: ** Alpha-glucan water dikinase...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12203 RXN-12203] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Alpha-glucan water dikinase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.7.9.4 EC-2.7.9.4] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** n [[ATP]][c] '''+''' n [[WATER]][c] '''+''' 1 [[Starch]][c] '''=>''' n [[AMP]][c] '''+''' n [[Pi]][c] '''+''' 1 [[6-Phosphogluco-Amylopectins]][c] | |
| − | + | * With common name(s): | |
| − | * [[ | + | ** n ATP[c] '''+''' n H2O[c] '''+''' 1 starch[c] '''=>''' n AMP[c] '''+''' n phosphate[c] '''+''' 1 a 6-phosphogluco-amylopectin[c] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * [[CHC_T00008789001]] |
| − | * [[ | + | ** ORIGINAL_GENOME |
| − | + | ***AUTOMATED-NAME-MATCH | |
| + | == Pathways == | ||
| + | * [[PWY-6724]], starch degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6724 PWY-6724] | ||
| + | ** '''6''' reactions found over '''9''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[annotation]]: | ||
| + | ** [[pathwaytools]]: | ||
| + | *** [[original_genome]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=Alpha-glucan water dikinase}} | |
| − | + | {{#set: ec number=EC-2.7.9.4}} | |
| − | + | {{#set: gene associated=CHC_T00008789001}} | |
| − | + | {{#set: in pathway=PWY-6724}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | {{#set: reconstruction source=original_genome}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 11:31, 18 January 2018
Contents
Reaction RXN-12203
- direction:
- LEFT-TO-RIGHT
- common name:
- Alpha-glucan water dikinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- n ATP[c] + n H2O[c] + 1 starch[c] => n AMP[c] + n phosphate[c] + 1 a 6-phosphogluco-amylopectin[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- CHC_T00008789001
- ORIGINAL_GENOME
- AUTOMATED-NAME-MATCH
- ORIGINAL_GENOME
