Difference between revisions of "RXN-8759"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-304 RXN66-304] == * direction: ** LEFT-TO-RIGHT * common name: ** 14-hydroxylanosterol 14-deh...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-304 RXN66-304] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 14-hydroxylanosterol 14-dehydrogenase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[PROTON]][c] '''+''' 1 [[CPD-4568]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADPH]][c] '''=>''' 2 [[WATER]][c] '''+''' 1 [[CPD-4573]][c] '''+''' 1 [[NADP]][c] |
− | = | + | * With common name(s): |
+ | ** 1 H+[c] '''+''' 1 14-hydroxylanosterol[c] '''+''' 1 oxygen[c] '''+''' 1 NADPH[c] '''=>''' 2 H2O[c] '''+''' 1 14-oxolanosterol[c] '''+''' 1 NADP+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[CHC_T00009303001_1]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | * [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341] | ||
+ | ** '''14''' reactions found over '''22''' reactions in the full pathway | ||
+ | * [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4] | ||
+ | ** '''15''' reactions found over '''22''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[galdieria.sulphuraria]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=14-hydroxylanosterol 14-dehydrogenase}} | |
− | {{#set: | + | {{#set: gene associated=CHC_T00009303001_1}} |
− | {{#set: | + | {{#set: in pathway=PWY66-341|PWY66-4}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | {{#set: reconstruction source=galdieria.sulphuraria}} |
Revision as of 11:31, 18 January 2018
Contents
Reaction RXN66-304
- direction:
- LEFT-TO-RIGHT
- common name:
- 14-hydroxylanosterol 14-dehydrogenase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H+[c] + 1 14-hydroxylanosterol[c] + 1 oxygen[c] + 1 NADPH[c] => 2 H2O[c] + 1 14-oxolanosterol[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY66-341, cholesterol biosynthesis I: PWY66-341
- 14 reactions found over 22 reactions in the full pathway
- PWY66-4, cholesterol biosynthesis III (via desmosterol): PWY66-4
- 15 reactions found over 22 reactions in the full pathway