Difference between revisions of "PWY-7197"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ALANINE D-ALANINE] == * smiles: ** CC([N+])C([O-])=O * inchi key: ** InChIKey=QNAYBMKLOCPYGJ-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12128 CPD-12128] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12128 CPD-12128] == |
* smiles: | * smiles: | ||
| − | ** CC( | + | ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ZXHQKRGMWKZWGN-RYZSZPJESA-N |
* common name: | * common name: | ||
| − | ** | + | ** menaquinol-11 |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 923.499 |
* Synonym(s): | * Synonym(s): | ||
| + | ** MKH2-11 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9362]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479543 45479543] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84547 84547] |
| − | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C}} | |
| − | {{#set: smiles=CC( | + | {{#set: inchi key=InChIKey=ZXHQKRGMWKZWGN-RYZSZPJESA-N}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=menaquinol-11}} |
| − | {{#set: common name= | + | {{#set: molecular weight=923.499 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=MKH2-11}} |
| − | {{#set: | + | {{#set: produced by=RXN-9362}} |
| − | {{#set: | + | |
Revision as of 11:32, 18 January 2018
Contents
Metabolite CPD-12128
- smiles:
- CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C
- inchi key:
- InChIKey=ZXHQKRGMWKZWGN-RYZSZPJESA-N
- common name:
- menaquinol-11
- molecular weight:
- 923.499
- Synonym(s):
- MKH2-11
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
