Difference between revisions of "PWY-5268"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4341 PWY-4341] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4341 PWY-4341] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
−
** InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N
+
 
* common name:
 
* common name:
−
** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
+
** L-glutamate biosynthesis V
−
* molecular weight:
+
−
** 414.713   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-13711]]
+
* '''1''' reaction(s) found
−
* [[RXN66-15]]
+
** [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) not found ==
−
* [[RXN66-14]]
+
* '''0''' reaction(s) not found
−
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12070223 12070223]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-4341 PWY-4341]
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://www.chemspider.com/Chemical-Structure.10474091.html 10474091]
+
{{#set: taxonomic range=TAX-1117}}
−
* LIGAND-CPD:
+
{{#set: common name=L-glutamate biosynthesis V}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15915 C15915]
+
{{#set: reaction found=1}}
−
* HMDB : HMDB06840
+
{{#set: reaction not found=0}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
−
{{#set: inchi key=InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N}}
+
−
{{#set: common name=4,4-dimethyl-5α-cholesta-8-en-3-β-ol}}
+
−
{{#set: molecular weight=414.713    }}
+
−
{{#set: consumed by=RXN-13711|RXN66-15}}
+
−
{{#set: produced by=RXN66-14}}
+

Revision as of 12:32, 18 January 2018

Pathway PWY-4341

  • taxonomic range:
  • common name:
    • L-glutamate biosynthesis V
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

  • 0 reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-5268&oldid=8579"