Difference between revisions of "RXN-16317"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * smiles: ** C(O)C1(OC(C(C(C1O)=O)O)O) * inchi key: ** InChIKey=APIQNBNBI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1602 RXN0-1602] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1602 RXN0-1602] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/3.6.1.66 EC-3.6.1.66] | |
| − | * | + | |
| − | ** 3- | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[DITP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[DIMP]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 H2O[c] '''+''' 1 dITP[c] '''=>''' 1 diphosphate[c] '''+''' 1 H+[c] '''+''' 1 dIMP[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[CHC_T00009365001_1]] | ||
| + | ** [[pantograph]]-[[a.taliana]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[a.taliana]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28342 28342] |
| − | + | * LIGAND-RXN: | |
| − | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03531 R03531] |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | + | {{#set: ec number=EC-3.6.1.66}} | |
| − | + | {{#set: gene associated=CHC_T00009365001_1}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | {{#set: | + | {{#set: reconstruction source=a.taliana}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 10:46, 18 January 2018
Contents
Reaction RXN0-1602
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H2O[c] + 1 dITP[c] => 1 diphosphate[c] + 1 H+[c] + 1 dIMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links
